C14H20N4O4S2 — CID 70725869
1-[(4aR,7aS)-4-[4-methyl-2-(methylamino)-1,3-thiazole-5-carbonyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanone (PubChem CID 70725869) has the molecular formula C14H20N4O4S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-[4-methyl-2-(methylamino)-1,3-thiazole-5-carbonyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanone.
| Compound Name | 1-[(4aR,7aS)-4-[4-methyl-2-(methylamino)-1,3-thiazole-5-carbonyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanone |
|---|---|
| PubChem CID | 70725869 |
| Molecular Formula | C14H20N4O4S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-[(4aR,7aS)-4-[4-methyl-2-(methylamino)-1,3-thiazole-5-carbonyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanone |
| SMILES | CNc1nc(C)c(C(=O)N2CCN(C(C)=O)[C@@H]3CS(=O)(=O)C[C@@H]32)s1 |
| InChI | InChI=1S/C14H20N4O4S2/c1-8-12(23-14(15-3)16-8)13(20)18-5-4-17(9(2)19)10-6-24(21,22)7-11(10)18/h10-11H,4-7H2,1-3H3,(H,15,16)/t10-,11+/m1/s1 |
| InChIKey | JAUJQVBKZHRGED-MNOVXSKESA-N |
| XLogP | -0.04 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |