C20H24N2O6S — CID 171910700
3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-7-propoxychromen-2-one (PubChem CID 171910700) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is 3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-7-propoxychromen-2-one.
| Compound Name | 3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-7-propoxychromen-2-one |
|---|---|
| PubChem CID | 171910700 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-7-propoxychromen-2-one |
| SMILES | CCCOc1ccc2cc(C(=O)N3CCN(C)[C@@H]4CS(=O)(=O)C[C@@H]43)c(=O)oc2c1 |
| InChI | InChI=1S/C20H24N2O6S/c1-3-8-27-14-5-4-13-9-15(20(24)28-18(13)10-14)19(23)22-7-6-21(2)16-11-29(25,26)12-17(16)22/h4-5,9-10,16-17H,3,6-8,11-12H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | KHJDEXMRLSIBMS-SJORKVTESA-N |
| XLogP | 1.13 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|