C17H28N4O3S — CID 70753004
[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[1-ethyl-3-(2-methylpropyl)pyrazol-5-yl]methanone (PubChem CID 70753004) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[1-ethyl-3-(2-methylpropyl)pyrazol-5-yl]methanone.
| Compound Name | [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[1-ethyl-3-(2-methylpropyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 70753004 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[1-ethyl-3-(2-methylpropyl)pyrazol-5-yl]methanone |
| SMILES | CCn1nc(CC(C)C)cc1C(=O)N1CCN(C)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H28N4O3S/c1-5-21-14(9-13(18-21)8-12(2)3)17(22)20-7-6-19(4)15-10-25(23,24)11-16(15)20/h9,12,15-16H,5-8,10-11H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | NXPDWQOUUQFWIO-CVEARBPZSA-N |
| XLogP | 0.65 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |