C16H26N4O3S — CID 70715337
[(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1-methyl-3-propylpyrazol-5-yl)methanone (PubChem CID 70715337) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1-methyl-3-propylpyrazol-5-yl)methanone.
| Compound Name | [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1-methyl-3-propylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 70715337 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1-methyl-3-propylpyrazol-5-yl)methanone |
| SMILES | CCCc1cc(C(=O)N2CCN(CC)[C@@H]3CS(=O)(=O)C[C@@H]32)n(C)n1 |
| InChI | InChI=1S/C16H26N4O3S/c1-4-6-12-9-13(18(3)17-12)16(21)20-8-7-19(5-2)14-10-24(22,23)11-15(14)20/h9,14-15H,4-8,10-11H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | DRRCRGXBIPAULW-CABCVRRESA-N |
| XLogP | 0.32 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |