C17H28N4O2 — CID 70788238
3-butyl-1-methyl-4-(1-methyl-3-propylpyrazole-5-carbonyl)piperazin-2-one (PubChem CID 70788238) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-butyl-1-methyl-4-(1-methyl-3-propylpyrazole-5-carbonyl)piperazin-2-one.
| Compound Name | 3-butyl-1-methyl-4-(1-methyl-3-propylpyrazole-5-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 70788238 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-butyl-1-methyl-4-(1-methyl-3-propylpyrazole-5-carbonyl)piperazin-2-one |
| SMILES | CCCCC1C(=O)N(C)CCN1C(=O)c1cc(CCC)nn1C |
| InChI | InChI=1S/C17H28N4O2/c1-5-7-9-14-16(22)19(3)10-11-21(14)17(23)15-12-13(8-6-2)18-20(15)4/h12,14H,5-11H2,1-4H3 |
| InChIKey | ZTHWZNXSOLTPPY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |