C15H22N4O5S — CID 72934451
3-[(4aR,7aS)-4-(1-ethylpyrazole-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propanoic acid (PubChem CID 72934451) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3-[(4aR,7aS)-4-(1-ethylpyrazole-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propanoic acid.
| Compound Name | 3-[(4aR,7aS)-4-(1-ethylpyrazole-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 72934451 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-[(4aR,7aS)-4-(1-ethylpyrazole-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propanoic acid |
| SMILES | CCn1ccc(C(=O)N2CCN(CCC(=O)O)[C@@H]3CS(=O)(=O)C[C@@H]32)n1 |
| InChI | InChI=1S/C15H22N4O5S/c1-2-18-6-3-11(16-18)15(22)19-8-7-17(5-4-14(20)21)12-9-25(23,24)10-13(12)19/h3,6,12-13H,2,4-5,7-10H2,1H3,(H,20,21)/t12-,13+/m1/s1 |
| InChIKey | SNACKEZSMKUPOD-OLZOCXBDSA-N |
| XLogP | -0.70 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |