C13H20N4O5S2 — CID 133118073
[(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(1-ethylpyrazol-3-yl)methanone (PubChem CID 133118073) has the molecular formula C13H20N4O5S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is [(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(1-ethylpyrazol-3-yl)methanone.
| Compound Name | [(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(1-ethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 133118073 |
| Molecular Formula | C13H20N4O5S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(1-ethylpyrazol-3-yl)methanone |
| SMILES | CCn1ccc(C(=O)N2CCN(S(C)(=O)=O)[C@H]3CS(=O)(=O)C[C@H]32)n1 |
| InChI | InChI=1S/C13H20N4O5S2/c1-3-15-5-4-10(14-15)13(18)16-6-7-17(23(2,19)20)12-9-24(21,22)8-11(12)16/h4-5,11-12H,3,6-9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | GLXQUVBXORPJJB-NEPJUHHUSA-N |
| XLogP | -1.21 |
| TPSA | 109.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |