C14H22N4O3S — CID 70710878
[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-methylpyrazol-3-yl)methanone (PubChem CID 70710878) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is [(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-methylpyrazol-3-yl)methanone.
| Compound Name | [(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 70710878 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-methylpyrazol-3-yl)methanone |
| SMILES | CCCN1CCN(C(=O)c2ccnn2C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C14H22N4O3S/c1-3-6-17-7-8-18(13-10-22(20,21)9-12(13)17)14(19)11-4-5-15-16(11)2/h4-5,12-13H,3,6-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | KJYHJMHEUKDGST-OLZOCXBDSA-N |
| XLogP | -0.25 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |