C18H24N4O3S — CID 70726831
[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(7-methylimidazo[1,2-a]pyridin-2-yl)methanone (PubChem CID 70726831) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is [(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(7-methylimidazo[1,2-a]pyridin-2-yl)methanone.
| Compound Name | [(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(7-methylimidazo[1,2-a]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 70726831 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(7-methylimidazo[1,2-a]pyridin-2-yl)methanone |
| SMILES | CCCN1CCN(C(=O)c2cn3ccc(C)cc3n2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H24N4O3S/c1-3-5-20-7-8-22(16-12-26(24,25)11-15(16)20)18(23)14-10-21-6-4-13(2)9-17(21)19-14/h4,6,9-10,15-16H,3,5,7-8,11-12H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | PFQLYOLIMRPBTL-CVEARBPZSA-N |
| XLogP | 0.98 |
| TPSA | 74.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |