C17H19N3O3S2 — CID 169418081
[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[3-(1,2-thiazol-4-yl)phenyl]methanone (PubChem CID 169418081) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[3-(1,2-thiazol-4-yl)phenyl]methanone.
| Compound Name | [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[3-(1,2-thiazol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 169418081 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[3-(1,2-thiazol-4-yl)phenyl]methanone |
| SMILES | CN1CCN(C(=O)c2cccc(-c3cnsc3)c2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H19N3O3S2/c1-19-5-6-20(16-11-25(22,23)10-15(16)19)17(21)13-4-2-3-12(7-13)14-8-18-24-9-14/h2-4,7-9,15-16H,5-6,10-11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | DIEWPZXYTRYOQP-CVEARBPZSA-N |
| XLogP | 1.36 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |