C14H17FN2O5S2 — CID 133139259
[(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(3-fluorophenyl)methanone (PubChem CID 133139259) has the molecular formula C14H17FN2O5S2 and a molecular weight of 376.43 g/mol. Its IUPAC name is [(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(3-fluorophenyl)methanone.
| Compound Name | [(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 133139259 |
| Molecular Formula | C14H17FN2O5S2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-(3-fluorophenyl)methanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2cccc(F)c2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C14H17FN2O5S2/c1-23(19,20)17-6-5-16(12-8-24(21,22)9-13(12)17)14(18)10-3-2-4-11(15)7-10/h2-4,7,12-13H,5-6,8-9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | BFTPWJOYJSRRJB-OLZOCXBDSA-N |
| XLogP | -0.29 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |