C17H18F2N2O4S — CID 70722898
[(4aR,7aS)-4-(3,4-difluorobenzoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone (PubChem CID 70722898) has the molecular formula C17H18F2N2O4S and a molecular weight of 384.40 g/mol. Its IUPAC name is [(4aR,7aS)-4-(3,4-difluorobenzoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone.
| Compound Name | [(4aR,7aS)-4-(3,4-difluorobenzoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 70722898 |
| Molecular Formula | C17H18F2N2O4S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | [(4aR,7aS)-4-(3,4-difluorobenzoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CCN(C(=O)c2ccc(F)c(F)c2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H18F2N2O4S/c18-12-4-3-11(7-13(12)19)17(23)21-6-5-20(16(22)10-1-2-10)14-8-26(24,25)9-15(14)21/h3-4,7,10,14-15H,1-2,5-6,8-9H2/t14-,15+/m1/s1 |
| InChIKey | CEPFPZYZGBHRPV-CABCVRRESA-N |
| XLogP | 0.82 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |