C11H11F2NO3S — CID 110721410
(3,4-difluorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 110721410) has the molecular formula C11H11F2NO3S and a molecular weight of 275.28 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (3,4-difluorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 110721410 |
| Molecular Formula | C11H11F2NO3S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (3,4-difluorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H11F2NO3S/c12-9-2-1-8(7-10(9)13)11(15)14-3-5-18(16,17)6-4-14/h1-2,7H,3-6H2 |
| InChIKey | OZTTZABWLJFAHV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |