C12H15NO5S — CID 103957032
(3,4-dihydroxyphenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone (PubChem CID 103957032) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone.
| Compound Name | (3,4-dihydroxyphenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 103957032 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | (3,4-dihydroxyphenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(c1ccc(O)c(O)c1)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H15NO5S/c14-10-3-2-9(8-11(10)15)12(16)13-4-1-6-19(17,18)7-5-13/h2-3,8,14-15H,1,4-7H2 |
| InChIKey | JBWVGKHIANYZJD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|