C12H13ClINO3S — CID 103736208
(3-chloro-4-iodophenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone (PubChem CID 103736208) has the molecular formula C12H13ClINO3S and a molecular weight of 413.66 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone.
| Compound Name | (3-chloro-4-iodophenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 103736208 |
| Molecular Formula | C12H13ClINO3S |
| Molecular Weight | 413.66 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(c1ccc(I)c(Cl)c1)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H13ClINO3S/c13-10-8-9(2-3-11(10)14)12(16)15-4-1-6-19(17,18)7-5-15/h2-3,8H,1,4-7H2 |
| InChIKey | ITSOXZGRMPUYDI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.66 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|