C14H17ClIN3O2 — CID 103734756
4-(3-chloro-4-iodobenzoyl)-N-ethylpiperazine-1-carboxamide (PubChem CID 103734756) has the molecular formula C14H17ClIN3O2 and a molecular weight of 421.67 g/mol. Its IUPAC name is 4-(3-chloro-4-iodobenzoyl)-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-(3-chloro-4-iodobenzoyl)-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 103734756 |
| Molecular Formula | C14H17ClIN3O2 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 4-(3-chloro-4-iodobenzoyl)-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C(=O)c2ccc(I)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H17ClIN3O2/c1-2-17-14(21)19-7-5-18(6-8-19)13(20)10-3-4-12(16)11(15)9-10/h3-4,9H,2,5-8H2,1H3,(H,17,21) |
| InChIKey | JJHMULIIDHBJQZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|