C13H16Cl2N4O2 — CID 60716823
4-(2,6-dichloropyridine-4-carbonyl)-N-ethylpiperazine-1-carboxamide (PubChem CID 60716823) has the molecular formula C13H16Cl2N4O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 4-(2,6-dichloropyridine-4-carbonyl)-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-(2,6-dichloropyridine-4-carbonyl)-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 60716823 |
| Molecular Formula | C13H16Cl2N4O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 4-(2,6-dichloropyridine-4-carbonyl)-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C(=O)c2cc(Cl)nc(Cl)c2)CC1 |
| InChI | InChI=1S/C13H16Cl2N4O2/c1-2-16-13(21)19-5-3-18(4-6-19)12(20)9-7-10(14)17-11(15)8-9/h7-8H,2-6H2,1H3,(H,16,21) |
| InChIKey | LHNKJDJPNMKLTP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|