C14H18IN3O2 — CID 60698551
N-ethyl-4-(4-iodobenzoyl)piperazine-1-carboxamide (PubChem CID 60698551) has the molecular formula C14H18IN3O2 and a molecular weight of 387.22 g/mol. Its IUPAC name is N-ethyl-4-(4-iodobenzoyl)piperazine-1-carboxamide.
| Compound Name | N-ethyl-4-(4-iodobenzoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60698551 |
| Molecular Formula | C14H18IN3O2 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | N-ethyl-4-(4-iodobenzoyl)piperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C(=O)c2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C14H18IN3O2/c1-2-16-14(20)18-9-7-17(8-10-18)13(19)11-3-5-12(15)6-4-11/h3-6H,2,7-10H2,1H3,(H,16,20) |
| InChIKey | PDLPDYWPHKQIKG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|