C13H15ClIN3OS — CID 103220794
2-[4-(3-chloro-4-iodobenzoyl)piperazin-1-yl]ethanethioamide (PubChem CID 103220794) has the molecular formula C13H15ClIN3OS and a molecular weight of 423.71 g/mol. Its IUPAC name is 2-[4-(3-chloro-4-iodobenzoyl)piperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(3-chloro-4-iodobenzoyl)piperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 103220794 |
| Molecular Formula | C13H15ClIN3OS |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 422.97 |
| IUPAC Name | 2-[4-(3-chloro-4-iodobenzoyl)piperazin-1-yl]ethanethioamide |
| SMILES | NC(=S)CN1CCN(C(=O)c2ccc(I)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H15ClIN3OS/c14-10-7-9(1-2-11(10)15)13(19)18-5-3-17(4-6-18)8-12(16)20/h1-2,7H,3-6,8H2,(H2,16,20) |
| InChIKey | QDZFFKWYNHRCFL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|