C19H15NO5S — CID 169240438
2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)anthracene-9,10-dione (PubChem CID 169240438) has the molecular formula C19H15NO5S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)anthracene-9,10-dione.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 169240438 |
| Molecular Formula | C19H15NO5S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(C(=O)N3CCS(=O)(=O)CC3)ccc21 |
| InChI | InChI=1S/C19H15NO5S/c21-17-13-3-1-2-4-14(13)18(22)16-11-12(5-6-15(16)17)19(23)20-7-9-26(24,25)10-8-20/h1-6,11H,7-10H2 |
| InChIKey | RTCLIHMCOXHNRZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|