C22H20N2O5S — CID 170189844
1-[4-(9,10-dioxoanthracene-2-carbonyl)piperazin-1-yl]cyclopropane-1-sulfinic acid (PubChem CID 170189844) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is 1-[4-(9,10-dioxoanthracene-2-carbonyl)piperazin-1-yl]cyclopropane-1-sulfinic acid.
| Compound Name | 1-[4-(9,10-dioxoanthracene-2-carbonyl)piperazin-1-yl]cyclopropane-1-sulfinic acid |
|---|---|
| PubChem CID | 170189844 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 1-[4-(9,10-dioxoanthracene-2-carbonyl)piperazin-1-yl]cyclopropane-1-sulfinic acid |
| SMILES | O=C1c2ccccc2C(=O)c2cc(C(=O)N3CCN(C4(S(=O)O)CC4)CC3)ccc21 |
| InChI | InChI=1S/C22H20N2O5S/c25-19-15-3-1-2-4-16(15)20(26)18-13-14(5-6-17(18)19)21(27)23-9-11-24(12-10-23)22(7-8-22)30(28)29/h1-6,13H,7-12H2,(H,28,29) |
| InChIKey | RGNALJSBZJFQQL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|