C23H24N2O3S — CID 169240449
2-(4-butylsulfanylpiperazine-1-carbonyl)anthracene-9,10-dione (PubChem CID 169240449) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-(4-butylsulfanylpiperazine-1-carbonyl)anthracene-9,10-dione.
| Compound Name | 2-(4-butylsulfanylpiperazine-1-carbonyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 169240449 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-(4-butylsulfanylpiperazine-1-carbonyl)anthracene-9,10-dione |
| SMILES | CCCCSN1CCN(C(=O)c2ccc3c(c2)C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C23H24N2O3S/c1-2-3-14-29-25-12-10-24(11-13-25)23(28)16-8-9-19-20(15-16)22(27)18-7-5-4-6-17(18)21(19)26/h4-9,15H,2-3,10-14H2,1H3 |
| InChIKey | LDUKXFRFLXDRNC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|