C25H26N2O4 — CID 16764901
1-(9,10-dioxoanthracene-2-carbonyl)-N,N-diethylpiperidine-4-carboxamide (PubChem CID 16764901) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-(9,10-dioxoanthracene-2-carbonyl)-N,N-diethylpiperidine-4-carboxamide.
| Compound Name | 1-(9,10-dioxoanthracene-2-carbonyl)-N,N-diethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16764901 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1-(9,10-dioxoanthracene-2-carbonyl)-N,N-diethylpiperidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCN(C(=O)c2ccc3c(c2)C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C25H26N2O4/c1-3-26(4-2)24(30)16-11-13-27(14-12-16)25(31)17-9-10-20-21(15-17)23(29)19-8-6-5-7-18(19)22(20)28/h5-10,15-16H,3-4,11-14H2,1-2H3 |
| InChIKey | RWOWULKHYATJSN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|