C32H41N3O3 — CID 139906530
2-[4-[[4-(cyclohexylmethylamino)butylamino]methyl]piperidine-1-carbonyl]anthracene-9,10-dione (PubChem CID 139906530) has the molecular formula C32H41N3O3 and a molecular weight of 515.70 g/mol. Its IUPAC name is 2-[4-[[4-(cyclohexylmethylamino)butylamino]methyl]piperidine-1-carbonyl]anthracene-9,10-dione.
| Compound Name | 2-[4-[[4-(cyclohexylmethylamino)butylamino]methyl]piperidine-1-carbonyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 139906530 |
| Molecular Formula | C32H41N3O3 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | 2-[4-[[4-(cyclohexylmethylamino)butylamino]methyl]piperidine-1-carbonyl]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(C(=O)N3CCC(CNCCCCNCC4CCCCC4)CC3)ccc21 |
| InChI | InChI=1S/C32H41N3O3/c36-30-26-10-4-5-11-27(26)31(37)29-20-25(12-13-28(29)30)32(38)35-18-14-24(15-19-35)22-34-17-7-6-16-33-21-23-8-2-1-3-9-23/h4-5,10-13,20,23-24,33-34H,1-3,6-9,14-19,21-22H2 |
| InChIKey | VBYKSAKGMDMDFN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|