C22H22N2O5S — CID 175949360
1-(9,10-dioxoanthracene-2-carbonyl)-N,N-dimethylpiperidine-4-sulfonamide (PubChem CID 175949360) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-(9,10-dioxoanthracene-2-carbonyl)-N,N-dimethylpiperidine-4-sulfonamide.
| Compound Name | 1-(9,10-dioxoanthracene-2-carbonyl)-N,N-dimethylpiperidine-4-sulfonamide |
|---|---|
| PubChem CID | 175949360 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-(9,10-dioxoanthracene-2-carbonyl)-N,N-dimethylpiperidine-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)C1CCN(C(=O)c2ccc3c(c2)C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C22H22N2O5S/c1-23(2)30(28,29)15-9-11-24(12-10-15)22(27)14-7-8-18-19(13-14)21(26)17-6-4-3-5-16(17)20(18)25/h3-8,13,15H,9-12H2,1-2H3 |
| InChIKey | SLQGUTCRAIZGDM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|