C20H17N2O5S- — CID 170189766
[4-(9,10-dioxoanthracene-2-carbonyl)piperazin-1-yl]methanesulfinate (PubChem CID 170189766) has the molecular formula C20H17N2O5S- and a molecular weight of 397.43 g/mol. Its IUPAC name is [4-(9,10-dioxoanthracene-2-carbonyl)piperazin-1-yl]methanesulfinate.
| Compound Name | [4-(9,10-dioxoanthracene-2-carbonyl)piperazin-1-yl]methanesulfinate |
|---|---|
| PubChem CID | 170189766 |
| Molecular Formula | C20H17N2O5S- |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | [4-(9,10-dioxoanthracene-2-carbonyl)piperazin-1-yl]methanesulfinate |
| SMILES | O=C1c2ccccc2C(=O)c2cc(C(=O)N3CCN(CS(=O)[O-])CC3)ccc21 |
| InChI | InChI=1S/C20H18N2O5S/c23-18-14-3-1-2-4-15(14)19(24)17-11-13(5-6-16(17)18)20(25)22-9-7-21(8-10-22)12-28(26)27/h1-6,11H,7-10,12H2,(H,26,27)/p-1 |
| InChIKey | YJPPKXINYVCKPM-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|