C22H19NO7S2-2 — CID 170189748
[1-[9,10-dioxo-5-(sulfinatomethyl)anthracene-2-carbonyl]piperidin-4-yl]methanesulfinate (PubChem CID 170189748) has the molecular formula C22H19NO7S2-2 and a molecular weight of 473.53 g/mol. Its IUPAC name is [1-[9,10-dioxo-5-(sulfinatomethyl)anthracene-2-carbonyl]piperidin-4-yl]methanesulfinate.
| Compound Name | [1-[9,10-dioxo-5-(sulfinatomethyl)anthracene-2-carbonyl]piperidin-4-yl]methanesulfinate |
|---|---|
| PubChem CID | 170189748 |
| Molecular Formula | C22H19NO7S2-2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | [1-[9,10-dioxo-5-(sulfinatomethyl)anthracene-2-carbonyl]piperidin-4-yl]methanesulfinate |
| SMILES | O=C1c2cc(C(=O)N3CCC(CS(=O)[O-])CC3)ccc2C(=O)c2c(CS(=O)[O-])cccc21 |
| InChI | InChI=1S/C22H21NO7S2/c24-20-17-3-1-2-15(12-32(29)30)19(17)21(25)16-5-4-14(10-18(16)20)22(26)23-8-6-13(7-9-23)11-31(27)28/h1-5,10,13H,6-9,11-12H2,(H,27,28)(H,29,30)/p-2 |
| InChIKey | BDVLKEJPOUVFDW-UHFFFAOYSA-L |
| XLogP | 1.57 |
| TPSA | 134.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|