C13H13FN2O2 — CID 131643478
1-(3-fluorobenzoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one (PubChem CID 131643478) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is 1-(3-fluorobenzoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | 1-(3-fluorobenzoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 131643478 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(3-fluorobenzoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one |
| SMILES | O=C1CC2C(CCN2C(=O)c2cccc(F)c2)N1 |
| InChI | InChI=1S/C13H13FN2O2/c14-9-3-1-2-8(6-9)13(18)16-5-4-10-11(16)7-12(17)15-10/h1-3,6,10-11H,4-5,7H2,(H,15,17) |
| InChIKey | KFYCMSSEOGFADZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |