C15H20ClN3O4S — CID 133115872
(4aS,7aR)-N-(3-chloro-4-methoxyphenyl)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 133115872) has the molecular formula C15H20ClN3O4S and a molecular weight of 373.86 g/mol. Its IUPAC name is (4aS,7aR)-N-(3-chloro-4-methoxyphenyl)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aS,7aR)-N-(3-chloro-4-methoxyphenyl)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 133115872 |
| Molecular Formula | C15H20ClN3O4S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (4aS,7aR)-N-(3-chloro-4-methoxyphenyl)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(C)[C@H]3CS(=O)(=O)C[C@H]32)cc1Cl |
| InChI | InChI=1S/C15H20ClN3O4S/c1-18-5-6-19(13-9-24(21,22)8-12(13)18)15(20)17-10-3-4-14(23-2)11(16)7-10/h3-4,7,12-13H,5-6,8-9H2,1-2H3,(H,17,20)/t12-,13+/m0/s1 |
| InChIKey | NCJXMXNCMXKEBR-QWHCGFSZSA-N |
| XLogP | 1.29 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |