C16H20ClN3O4S — CID 70718628
(4aR,7aS)-N-(4-chlorophenyl)-6,6-dioxo-1-propanoyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 70718628) has the molecular formula C16H20ClN3O4S and a molecular weight of 385.87 g/mol. Its IUPAC name is (4aR,7aS)-N-(4-chlorophenyl)-6,6-dioxo-1-propanoyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aR,7aS)-N-(4-chlorophenyl)-6,6-dioxo-1-propanoyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 70718628 |
| Molecular Formula | C16H20ClN3O4S |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | (4aR,7aS)-N-(4-chlorophenyl)-6,6-dioxo-1-propanoyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | CCC(=O)N1CCN(C(=O)Nc2ccc(Cl)cc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H20ClN3O4S/c1-2-15(21)19-7-8-20(14-10-25(23,24)9-13(14)19)16(22)18-12-5-3-11(17)4-6-12/h3-6,13-14H,2,7-10H2,1H3,(H,18,22)/t13-,14+/m1/s1 |
| InChIKey | NWORJLFWPMBGCU-KGLIPLIRSA-N |
| XLogP | 1.59 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |