C18H24N2O6S — CID 70768960
1-[(4aS,7aR)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(2-methoxyphenyl)ethanone (PubChem CID 70768960) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-[(4aS,7aR)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(2-methoxyphenyl)ethanone.
| Compound Name | 1-[(4aS,7aR)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 70768960 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-[(4aS,7aR)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(2-methoxyphenyl)ethanone |
| SMILES | COCC(=O)N1CCN(C(=O)Cc2ccccc2OC)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H24N2O6S/c1-25-10-18(22)20-8-7-19(14-11-27(23,24)12-15(14)20)17(21)9-13-5-3-4-6-16(13)26-2/h3-6,14-15H,7-12H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | KOBYUIKCGQPSQD-LSDHHAIUSA-N |
| XLogP | -0.28 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |