C23H34N2O5 — CID 47088995
tert-butyl 2-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-2-yl]pyrrolidine-1-carboxylate (PubChem CID 47088995) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is tert-butyl 2-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 47088995 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | tert-butyl 2-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-2-yl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccccc1OCC(=O)N1CCCCC1C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34N2O5/c1-23(2,3)30-22(27)25-15-9-11-18(25)17-10-7-8-14-24(17)21(26)16-29-20-13-6-5-12-19(20)28-4/h5-6,12-13,17-18H,7-11,14-16H2,1-4H3 |
| InChIKey | DNCHLOIYXTVDRI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |