C22H40N2O2 — CID 171567392
1,2-dimethoxybenzene;(6R)-1-methyl-6-piperidin-1-yl-2,3,3a,4,5,6,7,7a-octahydroindole;molecular hydrogen (PubChem CID 171567392) has the molecular formula C22H40N2O2 and a molecular weight of 364.57 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;(6R)-1-methyl-6-piperidin-1-yl-2,3,3a,4,5,6,7,7a-octahydroindole;molecular hydrogen.
| Compound Name | 1,2-dimethoxybenzene;(6R)-1-methyl-6-piperidin-1-yl-2,3,3a,4,5,6,7,7a-octahydroindole;molecular hydrogen |
|---|---|
| PubChem CID | 171567392 |
| Molecular Formula | C22H40N2O2 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | 1,2-dimethoxybenzene;(6R)-1-methyl-6-piperidin-1-yl-2,3,3a,4,5,6,7,7a-octahydroindole;molecular hydrogen |
| SMILES | CN1CCC2CC[C@@H](N3CCCCC3)CC21.COc1ccccc1OC.[H][H].[H][H] |
| InChI | InChI=1S/C14H26N2.C8H10O2.2H2/c1-15-10-7-12-5-6-13(11-14(12)15)16-8-3-2-4-9-16;1-9-7-5-3-4-6-8(7)10-2;;/h12-14H,2-11H2,1H3;3-6H,1-2H3;2*1H/t12?,13-,14?;;;/m1.../s1 |
| InChIKey | OWTORMUECJSSEL-CBWQAWGWSA-N |
| XLogP | 4.54 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |