C20H30N2O3 — CID 6733175
2-(2-methoxyphenyl)ethyl 4-piperidin-1-ylpiperidine-1-carboxylate (PubChem CID 6733175) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)ethyl 4-piperidin-1-ylpiperidine-1-carboxylate.
| Compound Name | 2-(2-methoxyphenyl)ethyl 4-piperidin-1-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 6733175 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2-(2-methoxyphenyl)ethyl 4-piperidin-1-ylpiperidine-1-carboxylate |
| SMILES | COc1ccccc1CCOC(=O)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C20H30N2O3/c1-24-19-8-4-3-7-17(19)11-16-25-20(23)22-14-9-18(10-15-22)21-12-5-2-6-13-21/h3-4,7-8,18H,2,5-6,9-16H2,1H3 |
| InChIKey | YKSWQMPJCBQYMU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |