C18H27N3O2 — CID 164909292
(2-aminophenyl) 4-(azepan-1-yl)piperidine-1-carboxylate (PubChem CID 164909292) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is (2-aminophenyl) 4-(azepan-1-yl)piperidine-1-carboxylate.
| Compound Name | (2-aminophenyl) 4-(azepan-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164909292 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (2-aminophenyl) 4-(azepan-1-yl)piperidine-1-carboxylate |
| SMILES | Nc1ccccc1OC(=O)N1CCC(N2CCCCCC2)CC1 |
| InChI | InChI=1S/C18H27N3O2/c19-16-7-3-4-8-17(16)23-18(22)21-13-9-15(10-14-21)20-11-5-1-2-6-12-20/h3-4,7-8,15H,1-2,5-6,9-14,19H2 |
| InChIKey | MESRBRFQILKNFY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|