About 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate
1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate (PubChem CID 167405018) has the molecular formula C14H22N4O2
and a molecular weight of 278.36 g/mol. Its IUPAC name is 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate |
| PubChem CID | 167405018 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate |
| SMILES | O=C(Oc1ccn[nH]1)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C14H22N4O2/c19-14(20-13-4-7-15-16-13)18-10-5-12(6-11-18)17-8-2-1-3-9-17/h4,7,12H,1-3,5-6,8-11H2,(H,15,16) |
| InChIKey | PTYNNXFQZIIOBG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate?
The IUPAC name of 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate (CID 167405018) is 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate.
What is the SMILES notation for 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate?
The canonical SMILES for 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate is O=C(Oc1ccn[nH]1)N1CCC(N2CCCCC2)CC1.
What is the InChIKey of 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate?
The InChIKey is PTYNNXFQZIIOBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O2/c19-14(20-13-4-7-15-16-13)18-10-5-12(6-11-18)17-8-2-1-3-9-17/h4,7,12H,1-3,5-6,8-11H2,(H,15,16).
What are the key properties of 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate?
1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate has a molecular weight of 278.36 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazol-5-yl 4-piperidin-1-ylpiperidine-1-carboxylate is sourced from PubChem (CID 167405018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).