C25H41N7O2 — CID 164909291
(2-aminophenyl) 4-(azepan-1-yl)piperidine-1-carboxylate;ethane;pyridine-2,3,6-triamine (PubChem CID 164909291) has the molecular formula C25H41N7O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is (2-aminophenyl) 4-(azepan-1-yl)piperidine-1-carboxylate;ethane;pyridine-2,3,6-triamine.
| Compound Name | (2-aminophenyl) 4-(azepan-1-yl)piperidine-1-carboxylate;ethane;pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 164909291 |
| Molecular Formula | C25H41N7O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | (2-aminophenyl) 4-(azepan-1-yl)piperidine-1-carboxylate;ethane;pyridine-2,3,6-triamine |
| SMILES | CC.Nc1ccc(N)c(N)n1.Nc1ccccc1OC(=O)N1CCC(N2CCCCCC2)CC1 |
| InChI | InChI=1S/C18H27N3O2.C5H8N4.C2H6/c19-16-7-3-4-8-17(16)23-18(22)21-13-9-15(10-14-21)20-11-5-1-2-6-12-20;6-3-1-2-4(7)9-5(3)8;1-2/h3-4,7-8,15H,1-2,5-6,9-14,19H2;1-2H,6H2,(H4,7,8,9);1-2H3 |
| InChIKey | TUVSAGWRBQIYIR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|