C20H30N6O3 — CID 164908912
3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;(2-aminophenyl) cyclopropanecarboxylate;ethane (PubChem CID 164908912) has the molecular formula C20H30N6O3 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;(2-aminophenyl) cyclopropanecarboxylate;ethane.
| Compound Name | 3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;(2-aminophenyl) cyclopropanecarboxylate;ethane |
|---|---|
| PubChem CID | 164908912 |
| Molecular Formula | C20H30N6O3 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;(2-aminophenyl) cyclopropanecarboxylate;ethane |
| SMILES | CC.NCCC(=O)Nc1ccc(N)c(N)n1.Nc1ccccc1OC(=O)C1CC1 |
| InChI | InChI=1S/C10H11NO2.C8H13N5O.C2H6/c11-8-3-1-2-4-9(8)13-10(12)7-5-6-7;9-4-3-7(14)12-6-2-1-5(10)8(11)13-6;1-2/h1-4,7H,5-6,11H2;1-2H,3-4,9-10H2,(H3,11,12,13,14);1-2H3 |
| InChIKey | WLOWFIKDVRSEAU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 172.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|