C18H27N7O3 — CID 164909099
2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;(2-aminophenyl) 3-(dimethylamino)propanoate (PubChem CID 164909099) has the molecular formula C18H27N7O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;(2-aminophenyl) 3-(dimethylamino)propanoate.
| Compound Name | 2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;(2-aminophenyl) 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 164909099 |
| Molecular Formula | C18H27N7O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;(2-aminophenyl) 3-(dimethylamino)propanoate |
| SMILES | CN(C)CCC(=O)Oc1ccccc1N.NCC(=O)Nc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C11H16N2O2.C7H11N5O/c1-13(2)8-7-11(14)15-10-6-4-3-5-9(10)12;8-3-6(13)11-5-2-1-4(9)7(10)12-5/h3-6H,7-8,12H2,1-2H3;1-2H,3,8-9H2,(H3,10,11,12,13) |
| InChIKey | DOFHJOOTECGJJU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 175.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|