C17H24N6O5 — CID 164908700
(2-aminophenyl) 2,3-dihydroxypropanoate;N-(5,6-diamino-2-pyridinyl)-2-(methylamino)acetamide (PubChem CID 164908700) has the molecular formula C17H24N6O5 and a molecular weight of 392.42 g/mol. Its IUPAC name is (2-aminophenyl) 2,3-dihydroxypropanoate;N-(5,6-diamino-2-pyridinyl)-2-(methylamino)acetamide.
| Compound Name | (2-aminophenyl) 2,3-dihydroxypropanoate;N-(5,6-diamino-2-pyridinyl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 164908700 |
| Molecular Formula | C17H24N6O5 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (2-aminophenyl) 2,3-dihydroxypropanoate;N-(5,6-diamino-2-pyridinyl)-2-(methylamino)acetamide |
| SMILES | CNCC(=O)Nc1ccc(N)c(N)n1.Nc1ccccc1OC(=O)C(O)CO |
| InChI | InChI=1S/C9H11NO4.C8H13N5O/c10-6-3-1-2-4-8(6)14-9(13)7(12)5-11;1-11-4-7(14)12-6-3-2-5(9)8(10)13-6/h1-4,7,11-12H,5,10H2;2-3,11H,4,9H2,1H3,(H3,10,12,13,14) |
| InChIKey | KTQQNQQBESTLFE-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 198.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|