C17H20N6O5 — CID 164908857
2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;4-[(2-aminophenoxy)methyl]-1,3-dioxol-2-one (PubChem CID 164908857) has the molecular formula C17H20N6O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;4-[(2-aminophenoxy)methyl]-1,3-dioxol-2-one.
| Compound Name | 2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;4-[(2-aminophenoxy)methyl]-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 164908857 |
| Molecular Formula | C17H20N6O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-amino-N-(5,6-diamino-2-pyridinyl)acetamide;4-[(2-aminophenoxy)methyl]-1,3-dioxol-2-one |
| SMILES | NCC(=O)Nc1ccc(N)c(N)n1.Nc1ccccc1OCc1coc(=O)o1 |
| InChI | InChI=1S/C10H9NO4.C7H11N5O/c11-8-3-1-2-4-9(8)13-5-7-6-14-10(12)15-7;8-3-6(13)11-5-2-1-4(9)7(10)12-5/h1-4,6H,5,11H2;1-2H,3,8-9H2,(H3,10,11,12,13) |
| InChIKey | DLXACICUOUFQTC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 198.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|