C22H36N6O5 — CID 164909252
3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;1-(2-aminophenoxy)ethyl propan-2-yl carbonate;ethane (PubChem CID 164909252) has the molecular formula C22H36N6O5 and a molecular weight of 464.57 g/mol. Its IUPAC name is 3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;1-(2-aminophenoxy)ethyl propan-2-yl carbonate;ethane.
| Compound Name | 3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;1-(2-aminophenoxy)ethyl propan-2-yl carbonate;ethane |
|---|---|
| PubChem CID | 164909252 |
| Molecular Formula | C22H36N6O5 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 3-amino-N-(5,6-diamino-2-pyridinyl)propanamide;1-(2-aminophenoxy)ethyl propan-2-yl carbonate;ethane |
| SMILES | CC.CC(C)OC(=O)OC(C)Oc1ccccc1N.NCCC(=O)Nc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C12H17NO4.C8H13N5O.C2H6/c1-8(2)15-12(14)17-9(3)16-11-7-5-4-6-10(11)13;9-4-3-7(14)12-6-2-1-5(10)8(11)13-6;1-2/h4-9H,13H2,1-3H3;1-2H,3-4,9-10H2,(H3,11,12,13,14);1-2H3 |
| InChIKey | SZWTUVMYQMXFCG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 190.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|