C18H23N6O8P — CID 164909117
1-[[2-[[2-amino-6-(3-aminopropanoylamino)-3-pyridinyl]diazenyl]phenoxy]-hydroxyphosphoryl]oxyethyl methyl carbonate (PubChem CID 164909117) has the molecular formula C18H23N6O8P and a molecular weight of 482.39 g/mol. Its IUPAC name is 1-[[2-[[2-amino-6-(3-aminopropanoylamino)-3-pyridinyl]diazenyl]phenoxy]-hydroxyphosphoryl]oxyethyl methyl carbonate.
| Compound Name | 1-[[2-[[2-amino-6-(3-aminopropanoylamino)-3-pyridinyl]diazenyl]phenoxy]-hydroxyphosphoryl]oxyethyl methyl carbonate |
|---|---|
| PubChem CID | 164909117 |
| Molecular Formula | C18H23N6O8P |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 1-[[2-[[2-amino-6-(3-aminopropanoylamino)-3-pyridinyl]diazenyl]phenoxy]-hydroxyphosphoryl]oxyethyl methyl carbonate |
| SMILES | COC(=O)OC(C)OP(=O)(O)Oc1ccccc1/N=N/c1ccc(NC(=O)CCN)nc1N |
| InChI | InChI=1S/C18H23N6O8P/c1-11(30-18(26)29-2)31-33(27,28)32-14-6-4-3-5-12(14)23-24-13-7-8-15(22-17(13)20)21-16(25)9-10-19/h3-8,11H,9-10,19H2,1-2H3,(H,27,28)(H3,20,21,22,25)/b24-23+ |
| InChIKey | HLSPJNBYBDUMLC-WCWDXBQESA-N |
| XLogP | 2.99 |
| TPSA | 210.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|