C18H26N6O2 — CID 164908820
[2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] 2-methylbutanoate;N-methylmethanamine (PubChem CID 164908820) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] 2-methylbutanoate;N-methylmethanamine.
| Compound Name | [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] 2-methylbutanoate;N-methylmethanamine |
|---|---|
| PubChem CID | 164908820 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] 2-methylbutanoate;N-methylmethanamine |
| SMILES | CCC(C)C(=O)Oc1ccccc1/N=N/c1ccc(N)nc1N.CNC |
| InChI | InChI=1S/C16H19N5O2.C2H7N/c1-3-10(2)16(22)23-13-7-5-4-6-11(13)20-21-12-8-9-14(17)19-15(12)18;1-3-2/h4-10H,3H2,1-2H3,(H4,17,18,19);3H,1-2H3/b21-20+; |
| InChIKey | WNIIUVFONOJCBU-ANVLNOONSA-N |
| XLogP | 3.45 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|