C24H24N6O4 — CID 174260658
[2-[[2-amino-6-[(2-benzamidoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] 2-methylpropanoate (PubChem CID 174260658) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is [2-[[2-amino-6-[(2-benzamidoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] 2-methylpropanoate.
| Compound Name | [2-[[2-amino-6-[(2-benzamidoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 174260658 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | [2-[[2-amino-6-[(2-benzamidoacetyl)amino]-3-pyridinyl]diazenyl]phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccccc1/N=N/c1ccc(NC(=O)CNC(=O)c2ccccc2)nc1N |
| InChI | InChI=1S/C24H24N6O4/c1-15(2)24(33)34-19-11-7-6-10-17(19)29-30-18-12-13-20(28-22(18)25)27-21(31)14-26-23(32)16-8-4-3-5-9-16/h3-13,15H,14H2,1-2H3,(H,26,32)(H3,25,27,28,31)/b30-29+ |
| InChIKey | DGTLGFXAVIOQFY-QVIHXGFCSA-N |
| XLogP | 4.01 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|