C19H24N6O3 — CID 174263736
[2-[[2-amino-6-[[2-(methylamino)acetyl]amino]-3-pyridinyl]diazenyl]phenyl] 3-methylbutanoate (PubChem CID 174263736) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is [2-[[2-amino-6-[[2-(methylamino)acetyl]amino]-3-pyridinyl]diazenyl]phenyl] 3-methylbutanoate.
| Compound Name | [2-[[2-amino-6-[[2-(methylamino)acetyl]amino]-3-pyridinyl]diazenyl]phenyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 174263736 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [2-[[2-amino-6-[[2-(methylamino)acetyl]amino]-3-pyridinyl]diazenyl]phenyl] 3-methylbutanoate |
| SMILES | CNCC(=O)Nc1ccc(/N=N/c2ccccc2OC(=O)CC(C)C)c(N)n1 |
| InChI | InChI=1S/C19H24N6O3/c1-12(2)10-18(27)28-15-7-5-4-6-13(15)24-25-14-8-9-16(23-19(14)20)22-17(26)11-21-3/h4-9,12,21H,10-11H2,1-3H3,(H3,20,22,23,26)/b25-24+ |
| InChIKey | NLWIRMMBHJGPCL-OCOZRVBESA-N |
| XLogP | 3.19 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|