C20H27N5O2 — CID 174266374
[2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] 3,5-dimethylheptanoate (PubChem CID 174266374) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] 3,5-dimethylheptanoate.
| Compound Name | [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] 3,5-dimethylheptanoate |
|---|---|
| PubChem CID | 174266374 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] 3,5-dimethylheptanoate |
| SMILES | CCC(C)CC(C)CC(=O)Oc1ccccc1/N=N/c1ccc(N)nc1N |
| InChI | InChI=1S/C20H27N5O2/c1-4-13(2)11-14(3)12-19(26)27-17-8-6-5-7-15(17)24-25-16-9-10-18(21)23-20(16)22/h5-10,13-14H,4,11-12H2,1-3H3,(H4,21,22,23)/b25-24+ |
| InChIKey | HBQDGSTULFKKHU-OCOZRVBESA-N |
| XLogP | 5.03 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|