C23H23N7O2 — CID 164909180
[2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] (2S)-2-amino-3-(1-methylindol-3-yl)propanoate (PubChem CID 164909180) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] (2S)-2-amino-3-(1-methylindol-3-yl)propanoate.
| Compound Name | [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] (2S)-2-amino-3-(1-methylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 164909180 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [2-[(2,6-diamino-3-pyridinyl)diazenyl]phenyl] (2S)-2-amino-3-(1-methylindol-3-yl)propanoate |
| SMILES | Cn1cc(C[C@H](N)C(=O)Oc2ccccc2/N=N/c2ccc(N)nc2N)c2ccccc21 |
| InChI | InChI=1S/C23H23N7O2/c1-30-13-14(15-6-2-4-8-19(15)30)12-16(24)23(31)32-20-9-5-3-7-17(20)28-29-18-10-11-21(25)27-22(18)26/h2-11,13,16H,12,24H2,1H3,(H4,25,26,27)/b29-28+/t16-/m0/s1 |
| InChIKey | GHOYPMIWGXJXNI-UNMOGBHFSA-N |
| XLogP | 3.63 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|