C20H22N4O3 — CID 142660945
(2R)-2-[[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]-3-pyridin-2-ylpropanoic acid (PubChem CID 142660945) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]-3-pyridin-2-ylpropanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]-3-pyridin-2-ylpropanoic acid |
|---|---|
| PubChem CID | 142660945 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (2R)-2-[[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]-3-pyridin-2-ylpropanoic acid |
| SMILES | Cn1cc(C[C@@H](N)C(=O)N[C@H](Cc2ccccn2)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C20H22N4O3/c1-24-12-13(15-7-2-3-8-18(15)24)10-16(21)19(25)23-17(20(26)27)11-14-6-4-5-9-22-14/h2-9,12,16-17H,10-11,21H2,1H3,(H,23,25)(H,26,27)/t16-,17-/m1/s1 |
| InChIKey | MMXOHSMCKZZZAM-IAGOWNOFSA-N |
| XLogP | 1.26 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |