C18H28N4O7S — CID 164615812
(2R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(1-methylindol-3-yl)propanoic acid;sulfuric acid (PubChem CID 164615812) has the molecular formula C18H28N4O7S and a molecular weight of 444.51 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(1-methylindol-3-yl)propanoic acid;sulfuric acid.
| Compound Name | (2R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(1-methylindol-3-yl)propanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 164615812 |
| Molecular Formula | C18H28N4O7S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (2R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(1-methylindol-3-yl)propanoic acid;sulfuric acid |
| SMILES | Cn1cc(C[C@@H](NC(=O)[C@@H](N)CCCCN)C(=O)O)c2ccccc21.O=S(=O)(O)O |
| InChI | InChI=1S/C18H26N4O3.H2O4S/c1-22-11-12(13-6-2-3-8-16(13)22)10-15(18(24)25)21-17(23)14(20)7-4-5-9-19;1-5(2,3)4/h2-3,6,8,11,14-15H,4-5,7,9-10,19-20H2,1H3,(H,21,23)(H,24,25);(H2,1,2,3,4)/t14-,15+;/m0./s1 |
| InChIKey | YQQZWLCHGRXVTB-LDXVYITESA-N |
| XLogP | 0.09 |
| TPSA | 197.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|